Urolitin B (1139-83-9) Ishlab chiqaruvchi zavod

Urolitin B

Noyabr 9, 2020

Urolitin BSpekifikatsiyalar

Ism: Urolitin B
Kimyoviy nomi: 3-gidroksi-6H-dibenzo [b, d] piran-6-bitta
CAS: 1139-83-9
Kimyoviy formulalar: C13H8O3
Molekulyar Og'irligi: 212.2 g / mol
rang:  Oq chang
SMILES kodi: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Function: Urolitin B mitoxondriyal va mushaklarning ishini yaxshilaydi.

Urolitin B qarish paytida mushaklarning kuchi va chidamliligini yaxshilaydi.

Application: Urolitin B - bu ellagitannisning ichak mikroblari metabolitidir va tahlil tizimi va sharoitiga qarab kuchli antioksidant va pro-oksidant faolliklarni namoyish etadi. Urolitin B estrogenik va / yoki anti-estrogenik faollikni ham ko'rsatishi mumkin.
Eriydigan: N, N-dimetilformamid va dimetilmetilendan osonlikcha eriydi. Metanol, etanol va etil asetatda ozgina eriydigan sulfon
Saqlash harorati: Giggskopik, -20 ° S muzlatgich, inert atmosferada
Yuk tashish holati: Atrof muhit harorati ostida xavfli bo'lmagan kimyoviy moddalar sifatida yuboriladi. Ushbu mahsulot odatdagi yuk va bojxona vaqtida bir necha hafta davomida etarlicha barqaror.