Eng yaxshi urolitin B kukuni (1139-83-9) Ishlab chiqaruvchi va zavod

Urolitin B kukuni

Noyabr 9, 2020

Cofttek - Xitoyda eng yaxshi Urolitin B kukuni ishlab chiqaruvchisi. Fabrikamız oylik ishlab chiqarish quvvati 9001 kg bo'lgan to'liq ishlab chiqarishni boshqarish tizimiga (ISO14001 va ISO200) ega.


Status: Ommaviy ishlab chiqarishda
Birlik: 1 kg / sumka, 25 kg / baraban

Urolitin BSpekifikatsiyalar

Ism: Urolitin B
Kimyoviy nomi: 3-gidroksi-6H-dibenzo [b, d] piran-6-bitta
CAS: 1139-83-9
Kimyoviy formulalar: C13H8O3
Molekulyar Og'irligi: 212.2 g / mol
rang:  Oq chang
SMILES kodi: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Function: Urolitin B mitoxondriyal va mushaklarning ishini yaxshilaydi.

Urolitin B qarish paytida mushaklarning kuchi va chidamliligini yaxshilaydi.

Application: Urolitin B - bu ellagitannisning ichak mikroblari metabolitidir va tahlil tizimi va sharoitiga qarab kuchli antioksidant va pro-oksidant faolliklarni namoyish etadi. Urolitin B estrogenik va / yoki anti-estrogenik faollikni ham ko'rsatishi mumkin.
Eriydigan: N, N-dimetilformamid va dimetilmetilendan osonlikcha eriydi. Metanol, etanol va etil asetatda ozgina eriydigan sulfon
Saqlash harorati: Giggskopik, -20 ° S muzlatgich, inert atmosferada
Yuk tashish holati: Atrof muhit harorati ostida xavfli bo'lmagan kimyoviy moddalar sifatida yuboriladi. Ushbu mahsulot odatdagi yuk va bojxona vaqtida bir necha hafta davomida etarlicha barqaror.


Urolitin B NMR spektri

Urolitin B (1139-83-9) - NMR spektri


Agar sizga mahsulotning har bir partiyasi uchun COA, MSDS, HNMR va boshqa ma'lumotlar kerak bo'lsa, iltimos biz bilan bog'laning marketing menejeri.


Urolitinlarga kirish

Urolitinlar - ellagitannindan olingan ellagik kislotaning ikkilamchi metabolitlari. Odamlarda ellagitanninlar ichak mikroflorasi bilan ellag kislotasiga aylanadi, so'ngra u yo'g'on ichaklarda urolitin A, urolitin B, urolitin C va urolitin D ga aylanadi.

Urolitin A (UA) ellagitanninlarning eng ko'p tarqalgan metabolitidir. Ammo urolitin A har qanday parhez manbalarida tabiiy ravishda paydo bo'lishi ma'lum emas.

Urolitin B (UB) - bu ellagitanninlarni konvertatsiya qilish orqali ichakda hosil bo'lgan mo'l metabolit. Urolitin B boshqa barcha urolitin hosilalari katabolizatsiyadan so'ng oxirgi mahsulotdir. Urolitin B siydikda urolitin B glyukuronid sifatida uchraydi.

Urolitin A 8-Metil Eter Urolitin A sintezi jarayonida oraliq mahsulot bo'lib, u ellagitanninning muhim ikkilamchi metabolitidir va antioksidant va yallig'lanishga qarshi xususiyatlarga ega.


Urolitin A va B ta'sir mexanizmi

● Urolitin A mitofagiyani keltirib chiqaradi

Mitofagiya - bu avtofagiyaning bir shakli, bu ularning optimal ishlashi uchun zararlangan mitokondriyani yo'q qilishga yordam beradi. Avtofagiya sitoplazmatik tarkib buzilgan va natijada qayta ishlanadigan umumiy jarayonni anglatadi, mitofagiya esa mitoxondriyaning emirilishi va qayta ishlanishi.

Qarish paytida avtofagiyaning pasayishi mitoxondriya funktsiyasining pasayishiga olib keladigan jihatlardan biridir. Bundan tashqari, oksidlovchi stress ham past avtofagiyaga olib kelishi mumkin. Urolitin A selektiv otofagiya orqali zararlangan mitoxondriyalarni yo'q qilish qobiliyatiga ega.

● Antioksidant xususiyatlar

Oksidativ stress tanadagi erkin radikallar va antioksidant o'rtasida nomutanosiblik mavjud bo'lganda yuzaga keladi. Bu ortiqcha erkin radikallar ko'pincha surunkali kasalliklar, masalan yurak kasalliklari, diabet va saraton kasalligi bilan bog'liq.

A va B urolitinlari antioksidant ta'sirini erkin radikallarni va xususan hujayra ichidagi reaktiv kislorod turlarini (ROS) kamaytirish qobiliyatiga ega bo'lib, ba'zi hujayra turlarida lipid peroksidlanishini inhibe qiladi.

Bundan tashqari, urolitinlar ba'zi oksidlovchi fermentlarni, shu jumladan monoamin oksidaza A va tirozinazni inhibe qilishga qodir.

● Yallig'lanishga qarshi xususiyatlar

Yallig'lanish - bu bizning tanamiz infektsiyalar, shikastlanishlar va mikroblar kabi har qanday tushgan narsalarga qarshi kurashadigan tabiiy jarayon. Ammo surunkali yallig'lanish tanaga zarar etkazishi mumkin, chunki bu astma, yurak muammolari va saraton kabi turli xil kasalliklar bilan bog'liq. Surunkali yallig'lanish tanadagi davolanmagan o'tkir yallig'lanish, yuqumli kasalliklar yoki hatto erkin radikallar tufayli yuzaga kelishi mumkin.

Urolitin A va B azot oksidi ishlab chiqarishni inhibe qilib, yallig'lanishga qarshi xususiyatlarga ega. Ular yallig'lanish uchun javobgar bo'lgan azot oksidi sintaza (iNOS) oqsilini va mRNK ifloslanishini maxsus inhibe qiladi.

● Mikroblarga qarshi ta'sir

Mikroblar, shu jumladan bakteriyalar, zamburug'lar va viruslar tabiiy muhitda va hatto inson tanasida uchraydi. Ammo patogenlar deb ataladigan bir nechta mikroblar gripp, qizamiq va bezgak kabi yuqumli kasalliklarga olib kelishi mumkin.

Urolitin A va B kvorumni sezishni inhibe qilish orqali mikroblarga qarshi faolligini namoyish etishga qodir. Kvorumni sezish bakteriyalar bilan aloqa qilish usulidir, bu bakteriyalarga viruslar va qo'zg'aluvchanlik kabi infektsiya bilan bog'liq jarayonlarni aniqlash va nazorat qilish imkonini beradi.

● Proteinlarning glyukatsiyasini inhibe qilish

Glikatsiya deganda shakarning lipid yoki oqsilga ferment bo'lmagan biriktirilishi tushuniladi. Bu qandli diabet va boshqa kasalliklarda, shuningdek, qarishdagi asosiy biomarkerdir.

Yuqori protein glikatsiyasi giperglikemiyaning ikkinchi darajali ta'siri diabet va Altsgeymer kasalligi kabi yurak-qon tomir kasalliklarida katta ahamiyatga ega.

Urolitin A va B antioksidant xususiyatlarga ega, ular antioksidant faolligiga qaram bo'lmagan dozaga bog'liq.


Urolitin B foydalari

Urolitin B qo'shimchalari sog'liq uchun bir qator foydali xususiyatlarga ega va ularning aksariyati urolitin A foydalariga o'xshashdir.

(1) saratonga qarshi potentsial
Urolitin B ning yallig'lanishga qarshi xususiyatlari uni saraton kasalligiga qarshi kurashda yaxshi nomzod qiladi. Ba'zi tadqiqotchilar bu imkoniyatlarni fibroblastlar, mikrofaglar va endotelial hujayralar haqida xabar berishdi.

Tadqiqotlar shuni ko'rsatdiki, UB turli xil saraton turlarini, masalan prostata, yo'g'on ichak va qovuq saratonini oldini oladi.

Odamlarda yo'g'on ichak saraton hujayralari ishtirok etgan tadqiqotda ellagitanninlar, ellag kislotasi va A va B urolitinlari saratonga qarshi potentsiali uchun baholandi. Ularning aytishicha, barcha muolajalar saraton hujayralarining o'sishini inhibe qila oladi. Ular saraton hujayralarining ko'payishini turli bosqichlarda hujayra tsiklini ushlab turish va apoptozni qo'zg'atish orqali inhibe qildilar.

(2) Oksidlanish stressiga qarshi kurashishda yordam berishi mumkin
Urolitin B reaktiv kislorod turlari va ba'zi hujayralardagi lipid peroksidatsiyasini kamaytirish orqali mukammal antioksidant xususiyatlarga ega. ROSning yuqori darajasi Altsgeymer kasalligi kabi ko'plab kasalliklarga bog'liq.

Oksidlanish stressiga uchragan neyronal hujayralar bilan olib borilgan tadqiqotda, hujayralarni oksidlanishdan himoya qiladigan urolitin B qo'shimchasi, shuningdek urolitin A topilib, hujayralar yashovchanligi oshdi.

(3) Urolitin B xotirani kuchaytirishda
Urolitin b qonga to'siqni o'tkazuvchanligini yaxshilaganligi haqida xabar berilgan. Bu bilim faoliyatini yaxshilaydi.

Tadqiqotlar shuni ko'rsatadiki, urolitin B umumiy kognitiv funktsiyani yaxshilash orqali xotirani kuchaytirishi mumkin.

(4) mushaklarning yo'qolishini oldini oladi
Mushaklarning yo'qolishi turli xil sabablarga ko'ra paydo bo'lishi mumkin, masalan, parhezda qarish va oqsil etishmasligi. Mushaklarning yo'qolishini to'xtatish, cheklash yoki oldini olish uchun bir qator chora-tadbirlarni qo'llash mumkin, shu jumladan mashqlar, dorilar va aminokislotalar, shuningdek polifenollar.

Urolitinlarni polifenollar deb tasniflash mumkin va mushaklarning oqsil sintezini faollashtirish orqali mushaklarning yo'qolishining oldini olishda rol o'ynaydi.

Sichqonlar bilan olib borilgan tadqiqotlar davomida ma'lum vaqt davomida yuborilgan Urolitin B qo'shimchalari mushaklarning rivojlanishini kuchaytirishi aniqlandi, chunki mushaklar kattalashib borishi aniqlandi.

(5) Urolitin B yallig'lanish bilan kurashadi
Urolitin B yallig'lanish belgilarini kamaytirgan holda yallig'lanishga qarshi xususiyatlarga ega.

Buyrak fibrozini qo'zg'atgan kalamushlarni o'rganish jarayonida urolitin B buyrak shikastlanishini yaxshilaganligi aniqlandi. Bu buyrak faoliyatini, buyrakning morfologiyasini yaxshilaydi, shuningdek buyrak shikastlanishini kamaytiradi. Bu UB buyrak yallig'lanishini yumshatishga qodirligini ko'rsatadi.

(6) A va B urolitinlarining sinergetik foydalari
Sinergik ta'sirlar, shuningdek, urolitin A va B ning kognitiv funktsiyasi va qobiliyati bilan kombinatsiyasida qayd etilgan. Tadqiqotda ushbu kombinatsiyani demans bilan bog'liq bezovtalik yoki Altsgeymer buzilishi kabi kasalliklarni davolash yoki oldini olishda qo'llash mumkinligi aytilgan.

Urolitinlar bilan bog'liq boshqa foydalar;

  • nöro
  • Metabolik sindromni yaxshilaydi


Urolitin A va B oziq-ovqat manbalari

Urolitinlar hech qanday parhez manbalarida tabiiy ravishda topilishi ma'lum emas. Ular ellagitanninlardan hosil bo'lgan ellagik kislotalarni qayta ishlash samarasidir. Ellagitanninlar ichak mikrobiotasi tomonidan ellagin kislotalariga aylantiriladi va ellagin kislotasi keyinchalik ichakdagi metabolitlarga (urolitinlarga) aylanadi.

Ellagitanninlar tabiiy ravishda anor, qulupnay, ahududu, bulutli va böğürtlen, mevali uzum, bodom, guava, choy va yong'oq va kashtan kabi yong'oqlar, shuningdek, emanga o'xshash ichimliklar, masalan, qizil sharob va viski kabi oziq-ovqat manbalarida uchraydi. eman bochkalari.

Shuning uchun urolitin A oziq-ovqat va B urolitinli ovqatlar ellagitaninga boy ovqatlar degan xulosaga kelishimiz mumkin. Shunisi e'tiborga loyiqki, uning ikkinchi darajali metabolitlari (urolitinlar) biologik mavjud bo'lganda ellagitanninning bioavailability juda cheklangan.

Urolitinlarning ajralishi va ishlab chiqarilishi odamlar orasida juda xilma-xildir, chunki ellagitannindan konversiya ichakdagi mikrobiotaga bog'liq. Ushbu konversiyada o'ziga xos bakteriyalar mavjud va ularning ba'zilari yuqori, past yoki mavjud bo'lmagan tegishli mikrobiota bo'lgan shaxslar orasida farq qiladi. Oziq-ovqat manbalari ellagitannin darajasida ham farq qiladi. Demak, ellagitanninlarning potentsial foydalari bir kishidan boshqasiga farq qiladi.


Urolitin A va B qo'shimchalari

Urolitin A qo'shimchalari va Urolitin B qo'shimchalari bozorda ellagitaninga boy oziq-ovqat manbalari sifatida osonlikcha topiladi. Urolitin qo'shimchalari ham osonlikcha mavjud. Ko'pincha anor qo'shimchalari keng sotilgan va muvaffaqiyatli ishlatilgan. Ushbu qo'shimchalar mevalar yoki yong'oqlardan sintez qilinadi va suyuq yoki chang shaklida hosil bo'ladi.

Turli xil ovqatlardagi ellagitannin konsentratsiyasining o'zgarishi sababli urolitin xaridorlari uni oziq-ovqat manbasini hisobga olgan holda sotib olishadi. Xuddi shu narsa urolitin B kukuni yoki suyuq qo'shimchalarni sotib olishda ham qo'llaniladi.

Urolitin A kukuni yoki B bilan olib borilgan bir nechta odamlarning klinik tadkikotlari ushbu qo'shimchalarning qo'llanilishidan jiddiy yon ta'sirlarni bildirmadi.


  1. Garsiya-Munoz, Kristina; Vaillant, Fabrice (2014-12-02). "Ellagitanninlarning metabolik taqdiri: sog'liq uchun oqibatlari va innovatsion funktsional ovqatlarning tadqiqot istiqbollari". Oziq -ovqat fani va ovqatlanish bo'yicha tanqidiy sharhlar.
  2. Bialonska D, Kasimsetti SG, Xan SI, Ferreyra D (11 yil 2009 -noyabr). "Anor ellagitanninlarining ichak mikrobial metabolitlari bo'lgan urolitinlar hujayra asosidagi tahlilda kuchli antioksidant ta'sir ko'rsatadi". J Agric Food Chem.
  3. Bodvell, Grexem; Pottie, Yan; Nandaluru, Penchal (2011). "Urelitin M7 ning teskari elektron-talab Diels-Alderga asoslangan umumiy sintezi".